C25H44O5 — CID 53328656
(1S,6S,9R,13R,14S,15S,17R,19S)-14,15-dihydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one (PubChem CID 53328656) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is (1S,6S,9R,13R,14S,15S,17R,19S)-14,15-dihydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one.
| Compound Name | (1S,6S,9R,13R,14S,15S,17R,19S)-14,15-dihydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one |
|---|---|
| PubChem CID | 53328656 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | (1S,6S,9R,13R,14S,15S,17R,19S)-14,15-dihydroxy-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icosan-7-one |
| SMILES | C=C1C[C@@H](CCC)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@H](C[C@@H]2C)C[C@H](O)[C@@H](O)[C@H](C)C1 |
| InChI | InChI=1S/C25H44O5/c1-6-9-20-13-16(2)12-19(5)24(27)22(26)15-21-14-18(4)23(29-21)11-8-7-10-17(3)25(28)30-20/h17-24,26-27H,2,6-15H2,1,3-5H3/t17-,18-,19+,20+,21+,22-,23-,24-/m0/s1 |
| InChIKey | LXFADTHUMHNXQJ-QYGQCHEXSA-N |
| XLogP | 4.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|