C24H42O6 — CID 59923933
(3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-7,12,13-trihydroxy-3,4,5,6,7,9,11,13-octamethyl-14-prop-2-enyl-oxacyclotetradecane-2,10-dione (PubChem CID 59923933) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-7,12,13-trihydroxy-3,4,5,6,7,9,11,13-octamethyl-14-prop-2-enyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-7,12,13-trihydroxy-3,4,5,6,7,9,11,13-octamethyl-14-prop-2-enyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 59923933 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-7,12,13-trihydroxy-3,4,5,6,7,9,11,13-octamethyl-14-prop-2-enyl-oxacyclotetradecane-2,10-dione |
| SMILES | C=CC[C@H]1OC(=O)[C@H](C)[C@@H](C)[C@H](C)[C@@H](C)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C24H42O6/c1-10-11-19-24(9,29)21(26)17(6)20(25)13(2)12-23(8,28)18(7)15(4)14(3)16(5)22(27)30-19/h10,13-19,21,26,28-29H,1,11-12H2,2-9H3/t13-,14+,15+,16-,17+,18-,19-,21-,23-,24-/m1/s1 |
| InChIKey | PJKSRNUXPNDOMA-DUHSACJRSA-N |
| XLogP | 3.13 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|