C15H20O5S — CID 11312980
ethyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate (PubChem CID 11312980) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate.
| Compound Name | ethyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate |
|---|---|
| PubChem CID | 11312980 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | ethyl (5S)-5-hydroxy-6-[(R)-(4-methylphenyl)sulfinyl]-3-oxohexanoate |
| SMILES | CCOC(=O)CC(=O)C[C@H](O)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O5S/c1-3-20-15(18)9-12(16)8-13(17)10-21(19)14-6-4-11(2)5-7-14/h4-7,13,17H,3,8-10H2,1-2H3/t13-,21+/m0/s1 |
| InChIKey | DXXLLKOJHBSCRM-YEJXKQKISA-N |
| XLogP | 1.38 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|