C17H20ClF3N2O3 — CID 113133699
3-[N-acetyl-4-chloro-2-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 113133699) has the molecular formula C17H20ClF3N2O3 and a molecular weight of 392.81 g/mol. Its IUPAC name is 3-[N-acetyl-4-chloro-2-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-[N-acetyl-4-chloro-2-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 113133699 |
| Molecular Formula | C17H20ClF3N2O3 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-[N-acetyl-4-chloro-2-(trifluoromethyl)anilino]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)NCC1CCCO1)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C17H20ClF3N2O3/c1-11(24)23(7-6-16(25)22-10-13-3-2-8-26-13)15-5-4-12(18)9-14(15)17(19,20)21/h4-5,9,13H,2-3,6-8,10H2,1H3,(H,22,25) |
| InChIKey | JAFTUUMVMURWBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |