C19H17F3N2O4 — CID 113135306
methyl 3-[3-(N-acetyl-2,3,4-trifluoroanilino)propanoylamino]benzoate (PubChem CID 113135306) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is methyl 3-[3-(N-acetyl-2,3,4-trifluoroanilino)propanoylamino]benzoate.
| Compound Name | methyl 3-[3-(N-acetyl-2,3,4-trifluoroanilino)propanoylamino]benzoate |
|---|---|
| PubChem CID | 113135306 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | methyl 3-[3-(N-acetyl-2,3,4-trifluoroanilino)propanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCN(C(C)=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H17F3N2O4/c1-11(25)24(15-7-6-14(20)17(21)18(15)22)9-8-16(26)23-13-5-3-4-12(10-13)19(27)28-2/h3-7,10H,8-9H2,1-2H3,(H,23,26) |
| InChIKey | SXQNSRYEFKJQPU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|