C22H23NO2 — CID 11313608
(12S,16R)-13-cyclohexylidene-8-methyl-17-oxa-8-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14-pentaen-9-one (PubChem CID 11313608) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (12S,16R)-13-cyclohexylidene-8-methyl-17-oxa-8-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14-pentaen-9-one.
| Compound Name | (12S,16R)-13-cyclohexylidene-8-methyl-17-oxa-8-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14-pentaen-9-one |
|---|---|
| PubChem CID | 11313608 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (12S,16R)-13-cyclohexylidene-8-methyl-17-oxa-8-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,14-pentaen-9-one |
| SMILES | Cn1c(=O)c2c(c3ccccc31)O[C@@H]1C=CC(=C3CCCCC3)[C@@H]1C2 |
| InChI | InChI=1S/C22H23NO2/c1-23-19-10-6-5-9-16(19)21-18(22(23)24)13-17-15(11-12-20(17)25-21)14-7-3-2-4-8-14/h5-6,9-12,17,20H,2-4,7-8,13H2,1H3/t17-,20+/m0/s1 |
| InChIKey | KPESQRJQCUWAHW-FXAWDEMLSA-N |
| XLogP | 4.29 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |