C15H20Cl2N2O3S — CID 113141417
3-[2-(2,4-dichlorophenyl)ethyl-methylsulfonylamino]-N-prop-2-enylpropanamide (PubChem CID 113141417) has the molecular formula C15H20Cl2N2O3S and a molecular weight of 379.31 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethyl-methylsulfonylamino]-N-prop-2-enylpropanamide.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethyl-methylsulfonylamino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 113141417 |
| Molecular Formula | C15H20Cl2N2O3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethyl-methylsulfonylamino]-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)CCN(CCc1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C15H20Cl2N2O3S/c1-3-8-18-15(20)7-10-19(23(2,21)22)9-6-12-4-5-13(16)11-14(12)17/h3-5,11H,1,6-10H2,2H3,(H,18,20) |
| InChIKey | QZBWBVAWSVMDTF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|