C17H24N2O3S2 — CID 11314658
N-buta-2,3-dienyl-N-[(2E)-2-[(R)-tert-butylsulfinyl]iminoethyl]-4-methylbenzenesulfonamide (PubChem CID 11314658) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-buta-2,3-dienyl-N-[(2E)-2-[(R)-tert-butylsulfinyl]iminoethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-buta-2,3-dienyl-N-[(2E)-2-[(R)-tert-butylsulfinyl]iminoethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11314658 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-buta-2,3-dienyl-N-[(2E)-2-[(R)-tert-butylsulfinyl]iminoethyl]-4-methylbenzenesulfonamide |
| SMILES | C=C=CCN(C/C=N/[S@](=O)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24N2O3S2/c1-6-7-13-19(14-12-18-23(20)17(3,4)5)24(21,22)16-10-8-15(2)9-11-16/h7-12H,1,13-14H2,2-5H3/b18-12+/t23-/m1/s1 |
| InChIKey | CXILNVAGTFSMSK-FUAYJARZSA-N |
| XLogP | 2.86 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|