C19H25NO2S — CID 11681501
4-methyl-N-[(2E)-4-methylpenta-2,4-dienyl]-N-(4-methylpenta-2,3-dienyl)benzenesulfonamide (PubChem CID 11681501) has the molecular formula C19H25NO2S and a molecular weight of 331.48 g/mol. Its IUPAC name is 4-methyl-N-[(2E)-4-methylpenta-2,4-dienyl]-N-(4-methylpenta-2,3-dienyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2E)-4-methylpenta-2,4-dienyl]-N-(4-methylpenta-2,3-dienyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11681501 |
| Molecular Formula | C19H25NO2S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-methyl-N-[(2E)-4-methylpenta-2,4-dienyl]-N-(4-methylpenta-2,3-dienyl)benzenesulfonamide |
| SMILES | C=C(C)/C=C/CN(CC=C=C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H25NO2S/c1-16(2)8-6-14-20(15-7-9-17(3)4)23(21,22)19-12-10-18(5)11-13-19/h6-8,10-13H,1,14-15H2,2-5H3/b8-6+ |
| InChIKey | XIBCVRKITXDTHB-SOFGYWHQSA-N |
| XLogP | 4.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|