C22H24N2O7S3 — CID 11386909
S-ethyl (E)-4-[(4-methylphenyl)sulfonyl-[(E)-3-(4-nitrophenyl)sulfonylprop-2-enyl]amino]but-2-enethioate (PubChem CID 11386909) has the molecular formula C22H24N2O7S3 and a molecular weight of 524.64 g/mol. Its IUPAC name is S-ethyl (E)-4-[(4-methylphenyl)sulfonyl-[(E)-3-(4-nitrophenyl)sulfonylprop-2-enyl]amino]but-2-enethioate.
| Compound Name | S-ethyl (E)-4-[(4-methylphenyl)sulfonyl-[(E)-3-(4-nitrophenyl)sulfonylprop-2-enyl]amino]but-2-enethioate |
|---|---|
| PubChem CID | 11386909 |
| Molecular Formula | C22H24N2O7S3 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | S-ethyl (E)-4-[(4-methylphenyl)sulfonyl-[(E)-3-(4-nitrophenyl)sulfonylprop-2-enyl]amino]but-2-enethioate |
| SMILES | CCSC(=O)/C=C/CN(C/C=C/S(=O)(=O)c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24N2O7S3/c1-3-32-22(25)6-4-15-23(34(30,31)21-11-7-18(2)8-12-21)16-5-17-33(28,29)20-13-9-19(10-14-20)24(26)27/h4-14,17H,3,15-16H2,1-2H3/b6-4+,17-5+ |
| InChIKey | FVIZRACQDBUCHF-VRQRLKGQSA-N |
| XLogP | 3.72 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|