C16H19NO5S2 — CID 101357170
S-ethyl (2E,7E)-8-(4-nitrophenyl)sulfonylocta-2,7-dienethioate (PubChem CID 101357170) has the molecular formula C16H19NO5S2 and a molecular weight of 369.46 g/mol. Its IUPAC name is S-ethyl (2E,7E)-8-(4-nitrophenyl)sulfonylocta-2,7-dienethioate.
| Compound Name | S-ethyl (2E,7E)-8-(4-nitrophenyl)sulfonylocta-2,7-dienethioate |
|---|---|
| PubChem CID | 101357170 |
| Molecular Formula | C16H19NO5S2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | S-ethyl (2E,7E)-8-(4-nitrophenyl)sulfonylocta-2,7-dienethioate |
| SMILES | CCSC(=O)/C=C/CCC/C=C/S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H19NO5S2/c1-2-23-16(18)8-6-4-3-5-7-13-24(21,22)15-11-9-14(10-12-15)17(19)20/h6-13H,2-5H2,1H3/b8-6+,13-7+ |
| InChIKey | DOCYBKUYNOEIPP-NQSFVOBFSA-N |
| XLogP | 3.89 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|