C16H25N3O5S — CID 113149927
ethyl 4-[[2-[2-(dimethylamino)ethyl-methylsulfonylamino]acetyl]amino]benzoate (PubChem CID 113149927) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(dimethylamino)ethyl-methylsulfonylamino]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-(dimethylamino)ethyl-methylsulfonylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 113149927 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl 4-[[2-[2-(dimethylamino)ethyl-methylsulfonylamino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(CCN(C)C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H25N3O5S/c1-5-24-16(21)13-6-8-14(9-7-13)17-15(20)12-19(25(4,22)23)11-10-18(2)3/h6-9H,5,10-12H2,1-4H3,(H,17,20) |
| InChIKey | JAROLCUBZBSHIC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |