C15H24N2O3S — CID 113154163
N,N-diethyl-2-(4-ethyl-N-methylsulfonylanilino)acetamide (PubChem CID 113154163) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N,N-diethyl-2-(4-ethyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N,N-diethyl-2-(4-ethyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113154163 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N,N-diethyl-2-(4-ethyl-N-methylsulfonylanilino)acetamide |
| SMILES | CCc1ccc(N(CC(=O)N(CC)CC)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-5-13-8-10-14(11-9-13)17(21(4,19)20)12-15(18)16(6-2)7-3/h8-11H,5-7,12H2,1-4H3 |
| InChIKey | JMWLOWCMJOHJCC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |