C17H26N2O5S — CID 113155892
methyl 2-[[2-(dipropylamino)-2-oxoethyl]-methylsulfonylamino]benzoate (PubChem CID 113155892) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is methyl 2-[[2-(dipropylamino)-2-oxoethyl]-methylsulfonylamino]benzoate.
| Compound Name | methyl 2-[[2-(dipropylamino)-2-oxoethyl]-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 113155892 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | methyl 2-[[2-(dipropylamino)-2-oxoethyl]-methylsulfonylamino]benzoate |
| SMILES | CCCN(CCC)C(=O)CN(c1ccccc1C(=O)OC)S(C)(=O)=O |
| InChI | InChI=1S/C17H26N2O5S/c1-5-11-18(12-6-2)16(20)13-19(25(4,22)23)15-10-8-7-9-14(15)17(21)24-3/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | BWVRGHSEWWNOIL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |