C18H17N3O5S — CID 113155919
methyl 2-[[2-(2-cyanoanilino)-2-oxoethyl]-methylsulfonylamino]benzoate (PubChem CID 113155919) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is methyl 2-[[2-(2-cyanoanilino)-2-oxoethyl]-methylsulfonylamino]benzoate.
| Compound Name | methyl 2-[[2-(2-cyanoanilino)-2-oxoethyl]-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 113155919 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | methyl 2-[[2-(2-cyanoanilino)-2-oxoethyl]-methylsulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(CC(=O)Nc1ccccc1C#N)S(C)(=O)=O |
| InChI | InChI=1S/C18H17N3O5S/c1-26-18(23)14-8-4-6-10-16(14)21(27(2,24)25)12-17(22)20-15-9-5-3-7-13(15)11-19/h3-10H,12H2,1-2H3,(H,20,22) |
| InChIKey | YRUWLCJYGFSEDZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |