C17H16F2N2O5S — CID 113157666
methyl 2-[[2-(2,6-difluoro-N-methylsulfonylanilino)acetyl]amino]benzoate (PubChem CID 113157666) has the molecular formula C17H16F2N2O5S and a molecular weight of 398.39 g/mol. Its IUPAC name is methyl 2-[[2-(2,6-difluoro-N-methylsulfonylanilino)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2,6-difluoro-N-methylsulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 113157666 |
| Molecular Formula | C17H16F2N2O5S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | methyl 2-[[2-(2,6-difluoro-N-methylsulfonylanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CN(c1c(F)cccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C17H16F2N2O5S/c1-26-17(23)11-6-3-4-9-14(11)20-15(22)10-21(27(2,24)25)16-12(18)7-5-8-13(16)19/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | IHJBFXSWGWINIB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |