C17H17FN2O5S — CID 113155917
methyl 2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylsulfonylamino]benzoate (PubChem CID 113155917) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl 2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylsulfonylamino]benzoate.
| Compound Name | methyl 2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 113155917 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | methyl 2-[[2-(3-fluoroanilino)-2-oxoethyl]-methylsulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(CC(=O)Nc1cccc(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C17H17FN2O5S/c1-25-17(22)14-8-3-4-9-15(14)20(26(2,23)24)11-16(21)19-13-7-5-6-12(18)10-13/h3-10H,11H2,1-2H3,(H,19,21) |
| InChIKey | HCHULFKODMCIEW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |