C18H31N3O3S — CID 113157055
2-[4-(diethylamino)-2-methyl-N-methylsulfonylanilino]-N-(2-methylpropyl)acetamide (PubChem CID 113157055) has the molecular formula C18H31N3O3S and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-[4-(diethylamino)-2-methyl-N-methylsulfonylanilino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[4-(diethylamino)-2-methyl-N-methylsulfonylanilino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 113157055 |
| Molecular Formula | C18H31N3O3S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[4-(diethylamino)-2-methyl-N-methylsulfonylanilino]-N-(2-methylpropyl)acetamide |
| SMILES | CCN(CC)c1ccc(N(CC(=O)NCC(C)C)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C18H31N3O3S/c1-7-20(8-2)16-9-10-17(15(5)11-16)21(25(6,23)24)13-18(22)19-12-14(3)4/h9-11,14H,7-8,12-13H2,1-6H3,(H,19,22) |
| InChIKey | XXJRRLALWIJTMB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|