C19H32N4O3S — CID 113157066
N-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]methanesulfonamide (PubChem CID 113157066) has the molecular formula C19H32N4O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]methanesulfonamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113157066 |
| Molecular Formula | C19H32N4O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]methanesulfonamide |
| SMILES | CCN(CC)c1ccc(N(CC(=O)N2CCN(C)CC2)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C19H32N4O3S/c1-6-21(7-2)17-8-9-18(16(3)14-17)23(27(5,25)26)15-19(24)22-12-10-20(4)11-13-22/h8-9,14H,6-7,10-13,15H2,1-5H3 |
| InChIKey | QRMYYHMZQRMMKJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|