C16H19ClN8OS — CID 11315753
1-[5-(2-chloro-6-methyl-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea (PubChem CID 11315753) has the molecular formula C16H19ClN8OS and a molecular weight of 406.90 g/mol. Its IUPAC name is 1-[5-(2-chloro-6-methyl-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea.
| Compound Name | 1-[5-(2-chloro-6-methyl-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 11315753 |
| Molecular Formula | C16H19ClN8OS |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[5-(2-chloro-6-methyl-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea |
| SMILES | CCn1nnc(CCNC(=O)Nc2nc(C)c(-c3cc(C)nc(Cl)c3)s2)n1 |
| InChI | InChI=1S/C16H19ClN8OS/c1-4-25-23-13(22-24-25)5-6-18-15(26)21-16-20-10(3)14(27-16)11-7-9(2)19-12(17)8-11/h7-8H,4-6H2,1-3H3,(H2,18,20,21,26) |
| InChIKey | JWASGIHSJMZGJT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|