C15H17ClN8OS — CID 87307398
1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea (PubChem CID 87307398) has the molecular formula C15H17ClN8OS and a molecular weight of 392.88 g/mol. Its IUPAC name is 1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea.
| Compound Name | 1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 87307398 |
| Molecular Formula | C15H17ClN8OS |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-[5-(2-chloro-4-pyridinyl)-4-methyl-1,3-thiazol-2-yl]-3-[2-(2-ethyltetrazol-5-yl)ethyl]urea |
| SMILES | CCn1nnc(CCNC(=O)Nc2nc(C)c(-c3ccnc(Cl)c3)s2)n1 |
| InChI | InChI=1S/C15H17ClN8OS/c1-3-24-22-12(21-23-24)5-7-18-14(25)20-15-19-9(2)13(26-15)10-4-6-17-11(16)8-10/h4,6,8H,3,5,7H2,1-2H3,(H2,18,19,20,25) |
| InChIKey | SBBJYPFESMACGP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|