C24H35N3O2 — CID 113159665
N-[2-(cyclohexen-1-yl)ethyl]-N-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]acetamide (PubChem CID 113159665) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 113159665 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)N(CCC1=CCCCC1)CC(=O)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C24H35N3O2/c1-19-8-7-11-23(20(19)2)25-14-16-26(17-15-25)24(29)18-27(21(3)28)13-12-22-9-5-4-6-10-22/h7-9,11H,4-6,10,12-18H2,1-3H3 |
| InChIKey | FVMWYPJYKXRMOG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|