C22H32N2O5Si — CID 11316425
methyl (3R)-5-benzamido-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyano-5-oxopentanoate (PubChem CID 11316425) has the molecular formula C22H32N2O5Si and a molecular weight of 432.59 g/mol. Its IUPAC name is methyl (3R)-5-benzamido-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyano-5-oxopentanoate.
| Compound Name | methyl (3R)-5-benzamido-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyano-5-oxopentanoate |
|---|---|
| PubChem CID | 11316425 |
| Molecular Formula | C22H32N2O5Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | methyl (3R)-5-benzamido-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-cyano-5-oxopentanoate |
| SMILES | COC(=O)C(C#N)[C@H](CCO[Si](C)(C)C(C)(C)C)CC(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O5Si/c1-22(2,3)30(5,6)29-13-12-17(18(15-23)21(27)28-4)14-19(25)24-20(26)16-10-8-7-9-11-16/h7-11,17-18H,12-14H2,1-6H3,(H,24,25,26)/t17-,18?/m1/s1 |
| InChIKey | MDGNDLGIVWBQQL-QNSVNVJESA-N |
| XLogP | 3.67 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|