C25H28N2O4Si — CID 102574384
methyl (2R,3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxo-2-phenylpentanoate (PubChem CID 102574384) has the molecular formula C25H28N2O4Si and a molecular weight of 448.60 g/mol. Its IUPAC name is methyl (2R,3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxo-2-phenylpentanoate.
| Compound Name | methyl (2R,3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxo-2-phenylpentanoate |
|---|---|
| PubChem CID | 102574384 |
| Molecular Formula | C25H28N2O4Si |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl (2R,3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxo-2-phenylpentanoate |
| SMILES | C=CC[Si](C)(C)[C@@H](CC(=O)NC(=O)c1ccccc1)[C@](C#N)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O4Si/c1-5-16-32(3,4)21(17-22(28)27-23(29)19-12-8-6-9-13-19)25(18-26,24(30)31-2)20-14-10-7-11-15-20/h5-15,21H,1,16-17H2,2-4H3,(H,27,28,29)/t21-,25+/m0/s1 |
| InChIKey | RJGREOJFKMEOOL-SQJMNOBHSA-N |
| XLogP | 4.23 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|