C20H17FN2O4 — CID 134918017
methyl (3S)-5-benzamido-2-cyano-3-(4-fluorophenyl)-5-oxopentanoate (PubChem CID 134918017) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is methyl (3S)-5-benzamido-2-cyano-3-(4-fluorophenyl)-5-oxopentanoate.
| Compound Name | methyl (3S)-5-benzamido-2-cyano-3-(4-fluorophenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 134918017 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | methyl (3S)-5-benzamido-2-cyano-3-(4-fluorophenyl)-5-oxopentanoate |
| SMILES | COC(=O)C(C#N)[C@H](CC(=O)NC(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17FN2O4/c1-27-20(26)17(12-22)16(13-7-9-15(21)10-8-13)11-18(24)23-19(25)14-5-3-2-4-6-14/h2-10,16-17H,11H2,1H3,(H,23,24,25)/t16-,17?/m1/s1 |
| InChIKey | WFDNRORLHXQWHU-TZHYSIJRSA-N |
| XLogP | 2.57 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |