C23H23FN2O4 — CID 134918096
methyl (2R,3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-(4-fluorophenyl)hexanoate (PubChem CID 134918096) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is methyl (2R,3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-(4-fluorophenyl)hexanoate.
| Compound Name | methyl (2R,3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-(4-fluorophenyl)hexanoate |
|---|---|
| PubChem CID | 134918096 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl (2R,3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-(4-fluorophenyl)hexanoate |
| SMILES | CCC[C@H](CC(=O)NC(=O)c1ccccc1)[C@@](C#N)(C(=O)OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O4/c1-3-7-18(14-20(27)26-21(28)16-8-5-4-6-9-16)23(15-25,22(29)30-2)17-10-12-19(24)13-11-17/h4-6,8-13,18H,3,7,14H2,1-2H3,(H,26,27,28)/t18-,23+/m1/s1 |
| InChIKey | XUBSNMWIRXGMTP-JPYJTQIMSA-N |
| XLogP | 3.52 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |