C24H23F3N2O4 — CID 135000274
methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-[3-(trifluoromethyl)phenyl]hexanoate (PubChem CID 135000274) has the molecular formula C24H23F3N2O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-[3-(trifluoromethyl)phenyl]hexanoate.
| Compound Name | methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-[3-(trifluoromethyl)phenyl]hexanoate |
|---|---|
| PubChem CID | 135000274 |
| Molecular Formula | C24H23F3N2O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-2-[3-(trifluoromethyl)phenyl]hexanoate |
| SMILES | CCC[C@H](CC(=O)NC(=O)c1ccccc1)C(C#N)(C(=O)OC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23F3N2O4/c1-3-8-17(14-20(30)29-21(31)16-9-5-4-6-10-16)23(15-28,22(32)33-2)18-11-7-12-19(13-18)24(25,26)27/h4-7,9-13,17H,3,8,14H2,1-2H3,(H,29,30,31)/t17-,23?/m1/s1 |
| InChIKey | NLBUAHBXNARKSH-LIXIDFRTSA-N |
| XLogP | 4.40 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |