C22H22F3NO4 — CID 7767493
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 7767493) has the molecular formula C22H22F3NO4 and a molecular weight of 421.42 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 7767493 |
| Molecular Formula | C22H22F3NO4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=O)COC(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H22F3NO4/c1-21(2,3)16-9-7-15(8-10-16)20(29)26-18(27)13-30-19(28)12-14-5-4-6-17(11-14)22(23,24)25/h4-11H,12-13H2,1-3H3,(H,26,27,29) |
| InChIKey | MLCHLLDBAIWDOJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |