C24H26N2O4 — CID 135001188
methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-5-methyl-2-phenylhexanoate (PubChem CID 135001188) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-5-methyl-2-phenylhexanoate.
| Compound Name | methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-5-methyl-2-phenylhexanoate |
|---|---|
| PubChem CID | 135001188 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl (3R)-3-(2-benzamido-2-oxoethyl)-2-cyano-5-methyl-2-phenylhexanoate |
| SMILES | COC(=O)C(C#N)(c1ccccc1)[C@@H](CC(=O)NC(=O)c1ccccc1)CC(C)C |
| InChI | InChI=1S/C24H26N2O4/c1-17(2)14-20(15-21(27)26-22(28)18-10-6-4-7-11-18)24(16-25,23(29)30-3)19-12-8-5-9-13-19/h4-13,17,20H,14-15H2,1-3H3,(H,26,27,28)/t20-,24?/m1/s1 |
| InChIKey | MOWNOCMJIMYMFH-CGHJUBPDSA-N |
| XLogP | 3.63 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |