C19H24N2O4Si — CID 102574381
methyl (3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxopentanoate (PubChem CID 102574381) has the molecular formula C19H24N2O4Si and a molecular weight of 372.50 g/mol. Its IUPAC name is methyl (3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxopentanoate.
| Compound Name | methyl (3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxopentanoate |
|---|---|
| PubChem CID | 102574381 |
| Molecular Formula | C19H24N2O4Si |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | methyl (3S)-5-benzamido-2-cyano-3-[dimethyl(prop-2-enyl)silyl]-5-oxopentanoate |
| SMILES | C=CC[Si](C)(C)[C@@H](CC(=O)NC(=O)c1ccccc1)C(C#N)C(=O)OC |
| InChI | InChI=1S/C19H24N2O4Si/c1-5-11-26(3,4)16(15(13-20)19(24)25-2)12-17(22)21-18(23)14-9-7-6-8-10-14/h5-10,15-16H,1,11-12H2,2-4H3,(H,21,22,23)/t15?,16-/m0/s1 |
| InChIKey | FNYLCRHANZACRY-LYKKTTPLSA-N |
| XLogP | 2.91 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|