C21H18F3NO4S — CID 11316534
2-[4-[(E)-3-cyano-2-[[4-(trifluoromethyl)phenoxy]methyl]prop-2-enyl]sulfanyl-2-methylphenoxy]acetic acid (PubChem CID 11316534) has the molecular formula C21H18F3NO4S and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[4-[(E)-3-cyano-2-[[4-(trifluoromethyl)phenoxy]methyl]prop-2-enyl]sulfanyl-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-cyano-2-[[4-(trifluoromethyl)phenoxy]methyl]prop-2-enyl]sulfanyl-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 11316534 |
| Molecular Formula | C21H18F3NO4S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[4-[(E)-3-cyano-2-[[4-(trifluoromethyl)phenoxy]methyl]prop-2-enyl]sulfanyl-2-methylphenoxy]acetic acid |
| SMILES | Cc1cc(SC/C(=C/C#N)COc2ccc(C(F)(F)F)cc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H18F3NO4S/c1-14-10-18(6-7-19(14)29-12-20(26)27)30-13-15(8-9-25)11-28-17-4-2-16(3-5-17)21(22,23)24/h2-8,10H,11-13H2,1H3,(H,26,27)/b15-8+ |
| InChIKey | HKAXGDWKRBVNPB-OVCLIPMQSA-N |
| XLogP | 5.10 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|