C15H19ClN2O4 — CID 113172652
N-(3-chloro-4-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide (PubChem CID 113172652) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide |
|---|---|
| PubChem CID | 113172652 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)N2CCOCC2)C(C)=O)cc1Cl |
| InChI | InChI=1S/C15H19ClN2O4/c1-11(19)18(10-15(20)17-5-7-22-8-6-17)12-3-4-14(21-2)13(16)9-12/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | ZMUMXKNWFJIGED-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |