C16H21ClN2O4 — CID 113180300
N-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide (PubChem CID 113180300) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide |
|---|---|
| PubChem CID | 113180300 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N-(2-morpholin-4-yl-2-oxoethyl)acetamide |
| SMILES | COc1cc(Cl)c(C)cc1N(CC(=O)N1CCOCC1)C(C)=O |
| InChI | InChI=1S/C16H21ClN2O4/c1-11-8-14(15(22-3)9-13(11)17)19(12(2)20)10-16(21)18-4-6-23-7-5-18/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | HHFYGMXQRQZHLS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |