C21H23N3O5 — CID 113175435
N-(3-acetylphenyl)-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]acetamide (PubChem CID 113175435) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | N-(3-acetylphenyl)-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 113175435 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-(3-acetylphenyl)-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]acetamide |
| SMILES | CC(=O)c1cccc(N(CC(=O)N2CCN(C(=O)c3ccco3)CC2)C(C)=O)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-15(25)17-5-3-6-18(13-17)24(16(2)26)14-20(27)22-8-10-23(11-9-22)21(28)19-7-4-12-29-19/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | WVPVFNMUMUXOPI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |