C18H21F3N2O2 — CID 113188524
4-(4-methylpiperidine-1-carbonyl)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 113188524) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-(4-methylpiperidine-1-carbonyl)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(4-methylpiperidine-1-carbonyl)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 113188524 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-(4-methylpiperidine-1-carbonyl)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CC1CCN(C(=O)C2CC(=O)N(c3ccccc3C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C18H21F3N2O2/c1-12-6-8-22(9-7-12)17(25)13-10-16(24)23(11-13)15-5-3-2-4-14(15)18(19,20)21/h2-5,12-13H,6-11H2,1H3 |
| InChIKey | OCSPZFAHVPDMMV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |