C21H25ClN2O — CID 113197535
2-(4-chlorophenyl)-2-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]propan-1-one (PubChem CID 113197535) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-(4-chlorophenyl)-2-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 113197535 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-(4-chlorophenyl)-2-methyl-1-[4-(3-methylphenyl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)C(C)(C)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25ClN2O/c1-16-5-4-6-19(15-16)23-11-13-24(14-12-23)20(25)21(2,3)17-7-9-18(22)10-8-17/h4-10,15H,11-14H2,1-3H3 |
| InChIKey | NVJNRKMTEZJSDL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |