C20H24N2O3 — CID 113199055
2-(3,4-dihydroxyphenyl)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethanone (PubChem CID 113199055) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3,4-dihydroxyphenyl)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 113199055 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-1-[4-(2,3-dimethylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(N2CCN(C(=O)Cc3ccc(O)c(O)c3)CC2)c1C |
| InChI | InChI=1S/C20H24N2O3/c1-14-4-3-5-17(15(14)2)21-8-10-22(11-9-21)20(25)13-16-6-7-18(23)19(24)12-16/h3-7,12,23-24H,8-11,13H2,1-2H3 |
| InChIKey | UHCUHVQBRRBQEG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|