C13H17ClFNO2 — CID 113219152
N-tert-butyl-2-(4-chloro-2-fluorophenoxy)propanamide (PubChem CID 113219152) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.74 g/mol. Its IUPAC name is N-tert-butyl-2-(4-chloro-2-fluorophenoxy)propanamide.
| Compound Name | N-tert-butyl-2-(4-chloro-2-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 113219152 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-tert-butyl-2-(4-chloro-2-fluorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1F)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H17ClFNO2/c1-8(12(17)16-13(2,3)4)18-11-6-5-9(14)7-10(11)15/h5-8H,1-4H3,(H,16,17) |
| InChIKey | FSGNDFNIFYNMRE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |