C15H23NO — CID 113219780
4-[[cyclopentyl(methyl)amino]methyl]-2,6-dimethylphenol (PubChem CID 113219780) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-[[cyclopentyl(methyl)amino]methyl]-2,6-dimethylphenol.
| Compound Name | 4-[[cyclopentyl(methyl)amino]methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 113219780 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-[[cyclopentyl(methyl)amino]methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(CN(C)C2CCCC2)cc(C)c1O |
| InChI | InChI=1S/C15H23NO/c1-11-8-13(9-12(2)15(11)17)10-16(3)14-6-4-5-7-14/h8-9,14,17H,4-7,10H2,1-3H3 |
| InChIKey | MVGQYULOOYRGNA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |