C10H16O5S — CID 11322613
S-ethyl (2R,3S,4R)-3,4-dihydroxy-5-oxo-2-propan-2-yloxolane-3-carbothioate (PubChem CID 11322613) has the molecular formula C10H16O5S and a molecular weight of 248.30 g/mol. Its IUPAC name is S-ethyl (2R,3S,4R)-3,4-dihydroxy-5-oxo-2-propan-2-yloxolane-3-carbothioate.
| Compound Name | S-ethyl (2R,3S,4R)-3,4-dihydroxy-5-oxo-2-propan-2-yloxolane-3-carbothioate |
|---|---|
| PubChem CID | 11322613 |
| Molecular Formula | C10H16O5S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | S-ethyl (2R,3S,4R)-3,4-dihydroxy-5-oxo-2-propan-2-yloxolane-3-carbothioate |
| SMILES | CCSC(=O)[C@@]1(O)[C@@H](C(C)C)OC(=O)[C@@H]1O |
| InChI | InChI=1S/C10H16O5S/c1-4-16-9(13)10(14)6(11)8(12)15-7(10)5(2)3/h5-7,11,14H,4H2,1-3H3/t6-,7+,10-/m0/s1 |
| InChIKey | MERWGKUHPBTCGY-PJKMHFRUSA-N |
| XLogP | -0.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|