C13H24O4S — CID 11254400
ethyl (2S,3S)-3-ethylsulfanylcarbonyl-2-hydroxy-2,5-dimethylhexanoate (PubChem CID 11254400) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is ethyl (2S,3S)-3-ethylsulfanylcarbonyl-2-hydroxy-2,5-dimethylhexanoate.
| Compound Name | ethyl (2S,3S)-3-ethylsulfanylcarbonyl-2-hydroxy-2,5-dimethylhexanoate |
|---|---|
| PubChem CID | 11254400 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | ethyl (2S,3S)-3-ethylsulfanylcarbonyl-2-hydroxy-2,5-dimethylhexanoate |
| SMILES | CCOC(=O)[C@@](C)(O)[C@H](CC(C)C)C(=O)SCC |
| InChI | InChI=1S/C13H24O4S/c1-6-17-12(15)13(5,16)10(8-9(3)4)11(14)18-7-2/h9-10,16H,6-8H2,1-5H3/t10-,13+/m1/s1 |
| InChIKey | CGOVQAZNJNWSCI-MFKMUULPSA-N |
| XLogP | 2.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|