C17H28O2 — CID 11323050
(2S,3R)-6-ethyl-3,5-dimethyl-2-[(E,4R)-4-methylhept-2-en-2-yl]-2,3-dihydropyran-4-one (PubChem CID 11323050) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (2S,3R)-6-ethyl-3,5-dimethyl-2-[(E,4R)-4-methylhept-2-en-2-yl]-2,3-dihydropyran-4-one.
| Compound Name | (2S,3R)-6-ethyl-3,5-dimethyl-2-[(E,4R)-4-methylhept-2-en-2-yl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 11323050 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (2S,3R)-6-ethyl-3,5-dimethyl-2-[(E,4R)-4-methylhept-2-en-2-yl]-2,3-dihydropyran-4-one |
| SMILES | CCC[C@@H](C)/C=C(\C)[C@H]1OC(CC)=C(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C17H28O2/c1-7-9-11(3)10-12(4)17-14(6)16(18)13(5)15(8-2)19-17/h10-11,14,17H,7-9H2,1-6H3/b12-10+/t11-,14+,17-/m1/s1 |
| InChIKey | CIXMYUBYRLMLKF-XUAYWUDSSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|