C11H22N2O3S — CID 113234945
3-methyl-N-(3-methylsulfonylpropyl)piperidine-1-carboxamide (PubChem CID 113234945) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 3-methyl-N-(3-methylsulfonylpropyl)piperidine-1-carboxamide.
| Compound Name | 3-methyl-N-(3-methylsulfonylpropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 113234945 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-methyl-N-(3-methylsulfonylpropyl)piperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)NCCCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-10-5-3-7-13(9-10)11(14)12-6-4-8-17(2,15)16/h10H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | LHLXKNFKSLKVRG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|