C13H26N2O2 — CID 86811915
3-methyl-N-(3-propan-2-yloxypropyl)piperidine-1-carboxamide (PubChem CID 86811915) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-methyl-N-(3-propan-2-yloxypropyl)piperidine-1-carboxamide.
| Compound Name | 3-methyl-N-(3-propan-2-yloxypropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86811915 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 3-methyl-N-(3-propan-2-yloxypropyl)piperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)NCCCOC(C)C)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-11(2)17-9-5-7-14-13(16)15-8-4-6-12(3)10-15/h11-12H,4-10H2,1-3H3,(H,14,16) |
| InChIKey | BMALYYDEGCZULR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|