C16H30O3Si — CID 11324011
tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,3-dien-3-yl]oxy-dimethylsilane (PubChem CID 11324011) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,3-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,3-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11324011 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | tert-butyl-[(1E,3Z)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-1,3-dien-3-yl]oxy-dimethylsilane |
| SMILES | C/C=C(/C=C/[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-9-13(19-20(7,8)15(2,3)4)10-11-14-12-17-16(5,6)18-14/h9-11,14H,12H2,1-8H3/b11-10+,13-9-/t14-/m0/s1 |
| InChIKey | CBBCTFVDEFPKPT-GLBFHAHASA-N |
| XLogP | 4.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|