C17H32O4 — CID 11324054
[(E,3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate (PubChem CID 11324054) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is [(E,3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate.
| Compound Name | [(E,3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 11324054 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | [(E,3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate |
| SMILES | COCOCCC/C=C/[C@@H](OC(=O)CCC(C)C)C(C)C |
| InChI | InChI=1S/C17H32O4/c1-14(2)10-11-17(18)21-16(15(3)4)9-7-6-8-12-20-13-19-5/h7,9,14-16H,6,8,10-13H2,1-5H3/b9-7+/t16-/m1/s1 |
| InChIKey | REHARZNXKNHAFD-MNDMWVCDSA-N |
| XLogP | 3.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|