C19H34O5 — CID 57271149
2-(3,3,3-tributoxyprop-1-enyl)cyclopropane-1-carboxylic acid (PubChem CID 57271149) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-(3,3,3-tributoxyprop-1-enyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-(3,3,3-tributoxyprop-1-enyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57271149 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-(3,3,3-tributoxyprop-1-enyl)cyclopropane-1-carboxylic acid |
| SMILES | CCCCOC(C=CC1CC1C(=O)O)(OCCCC)OCCCC |
| InChI | InChI=1S/C19H34O5/c1-4-7-12-22-19(23-13-8-5-2,24-14-9-6-3)11-10-16-15-17(16)18(20)21/h10-11,16-17H,4-9,12-15H2,1-3H3,(H,20,21) |
| InChIKey | CMHIHVGKOGDHGH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|