About [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate
[(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate (PubChem CID 91427283) has the molecular formula C17H32O4
and a molecular weight of 300.44 g/mol. Its IUPAC name is [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate.
Molecular Properties
| Compound Name | [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate |
| PubChem CID | 91427283 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate |
| SMILES | COCOCCCC=C[C@@H](OC(=O)CCC(C)C)C(C)C |
| InChI | InChI=1S/C17H32O4/c1-14(2)10-11-17(18)21-16(15(3)4)9-7-6-8-12-20-13-19-5/h7,9,14-16H,6,8,10-13H2,1-5H3/t16-/m1/s1 |
| InChIKey | REHARZNXKNHAFD-MRXNPFEDSA-N |
| XLogP | 3.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate?
The IUPAC name of [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate (CID 91427283) is [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate.
What is the SMILES notation for [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate?
The canonical SMILES for [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate is COCOCCCC=C[C@@H](OC(=O)CCC(C)C)C(C)C.
What is the InChIKey of [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate?
The InChIKey is REHARZNXKNHAFD-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H32O4/c1-14(2)10-11-17(18)21-16(15(3)4)9-7-6-8-12-20-13-19-5/h7,9,14-16H,6,8,10-13H2,1-5H3/t16-/m1/s1.
What are the key properties of [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate?
[(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate has a molecular weight of 300.44 g/mol, XLogP of 3.95, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-8-(methoxymethoxy)-2-methyloct-4-en-3-yl] 4-methylpentanoate is sourced from PubChem (CID 91427283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).