C25H42O6 — CID 134878952
methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-acetyloxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate (PubChem CID 134878952) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-acetyloxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-acetyloxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 134878952 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-acetyloxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1COC(C)(C)OC[C@@H]1C/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C25H42O6/c1-6-7-10-14-23(31-20(2)26)17-16-22-19-30-25(3,4)29-18-21(22)13-11-8-9-12-15-24(27)28-5/h8,11,16-17,21-23H,6-7,9-10,12-15,18-19H2,1-5H3/b11-8-,17-16+/t21-,22-,23-/m0/s1 |
| InChIKey | HYEQDAOGMCUBSA-SVAZBPEHSA-N |
| XLogP | 5.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|