C23H40O5 — CID 134937173
methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate (PubChem CID 134937173) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 134937173 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | methyl (Z)-7-[(5R,6R)-6-[(E,3S)-3-hydroxyoct-1-enyl]-2,2-dimethyl-1,3-dioxepan-5-yl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1COC(C)(C)OC[C@@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C23H40O5/c1-5-6-9-13-21(24)16-15-20-18-28-23(2,3)27-17-19(20)12-10-7-8-11-14-22(25)26-4/h7,10,15-16,19-21,24H,5-6,8-9,11-14,17-18H2,1-4H3/b10-7-,16-15+/t19-,20-,21-/m0/s1 |
| InChIKey | FFIAKHYLZFJUBL-UCSVTJHESA-N |
| XLogP | 4.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|